CAS 1219960-48-1

Piperidine, 4-(4-bromo-2-chlorophenoxy)-, hydrochloride (1:1)

Description:

Piperidine, 4-(4-bromo-2-chlorophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 4-(4-bromo-2-chlorophenoxy) substituent, indicating the presence of a phenoxy group that is further substituted with bromine and chlorine atoms, contributing to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in polar solvents, making it useful in various applications, including pharmaceuticals and organic synthesis. The presence of halogen substituents may influence its pharmacological properties, potentially affecting interactions with biological targets. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can exhibit toxicity and environmental concerns. Overall, this compound is of interest in medicinal chemistry and may serve as a precursor or intermediate in the synthesis of more complex molecules.

Formula: C₁₁H₁₃BrClNO·ClH

InChI: InChI=1S/C11H13BrClNO.ClH/c12-8-1-2-11(10(13)7-8)15-9-3-5-14-6-4-9;/h1-2,7,9,14H,3-6H2;1H

InChI key: InChIKey=TYJGLVMPFPWICA-UHFFFAOYSA-N

SMILES: O(C1=C(Cl)C=C(Br)C=C1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-(4-bromo-2-chlorophenoxy)-, hydrochloride (1:1)