CymitQuimica logo

CAS 1219960-53-8

:

Cyclopropanecarboxylic acid, 3-pyrrolidinyl ester, hydrochloride (1:1)

Description:
Cyclopropanecarboxylic acid, 3-pyrrolidinyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a pyrrolidine moiety. This compound typically exists as a hydrochloride salt, enhancing its solubility in polar solvents, which is beneficial for various applications in medicinal chemistry and pharmacology. The presence of the cyclopropanecarboxylic acid component contributes to its potential reactivity, while the pyrrolidine group may impart specific biological activity, making it of interest in drug development. The hydrochloride form often indicates that the compound can be used in biological systems, as it may improve stability and bioavailability. Additionally, the compound's molecular interactions can be influenced by the presence of the hydrochloride, affecting its pharmacokinetic properties. Overall, this compound's unique structural features and its salt form suggest potential utility in therapeutic applications, although specific biological activities would require further investigation through empirical studies.
Formula:C8H13NO2·ClH
InChI:InChI=1S/C8H13NO2.ClH/c10-8(6-1-2-6)11-7-3-4-9-5-7;/h6-7,9H,1-5H2;1H
InChI key:InChIKey=UZJMYNMSFSDLTG-UHFFFAOYSA-N
SMILES:C(OC1CCNC1)(=O)C2CC2.Cl
Synonyms:
  • Cyclopropanecarboxylic acid, 3-pyrrolidinyl ester, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.