
CAS 1219960-57-2
:Cyclopropanecarboxylic acid, 2-(2-piperidinyl)ethyl ester, hydrochloride (1:1)
Description:
Cyclopropanecarboxylic acid, 2-(2-piperidinyl)ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a piperidine moiety. This compound is typically a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to its free base. The presence of the piperidine group suggests potential biological activity, as piperidine derivatives are often found in pharmaceuticals. The compound may exhibit properties such as moderate to high lipophilicity, depending on the substituents and their arrangement, which can influence its pharmacokinetic profile. Additionally, the cyclopropane ring can impart strain, potentially affecting reactivity and stability. As with many organic compounds, it is essential to handle this substance with care, observing appropriate safety protocols due to potential toxicity or reactivity. Overall, this compound's characteristics make it of interest in medicinal chemistry and related fields.
Formula:C11H19NO2·ClH
InChI:InChI=1S/C11H19NO2.ClH/c13-11(9-4-5-9)14-8-6-10-3-1-2-7-12-10;/h9-10,12H,1-8H2;1H
InChI key:InChIKey=ODYYMPZNMQTRCS-UHFFFAOYSA-N
SMILES:C(OCCC1CCCCN1)(=O)C2CC2.Cl
Synonyms:- Cyclopropanecarboxylic acid, 2-(2-piperidinyl)ethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.