CAS 1219960-58-3

Piperidine, 3-[[2-(trifluoromethyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[[2-(trifluoromethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The presence of a trifluoromethyl group attached to a phenoxy methyl substituent enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The trifluoromethyl group is known for imparting unique electronic properties, potentially affecting the compound's reactivity and interaction with biological targets. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity. Overall, its structural features suggest potential utility in drug development or as a research chemical in various scientific studies.

Formula: C₁₃H₁₆F₃NO·ClH

InChI: InChI=1S/C13H16F3NO.ClH/c14-13(15,16)11-5-1-2-6-12(11)18-9-10-4-3-7-17-8-10;/h1-2,5-6,10,17H,3-4,7-9H2;1H

InChI key: InChIKey=FZXJLAOFLXGBPX-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(OCC2CCCNC2)C=CC=C1.Cl

Synonyms:

• Piperidine, 3-[[2-(trifluoromethyl)phenoxy]methyl]-, hydrochloride (1:1)