CAS 1219960-63-0

Cyclobutanecarboxylic acid, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1)

Description:

Cyclobutanecarboxylic acid, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclobutane ring and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The piperidine group contributes to its basicity and potential biological activity, making it of interest in medicinal chemistry. The ester functional group indicates that it can undergo hydrolysis, potentially releasing the corresponding carboxylic acid and alcohol. Its hydrochloride form enhances stability and solubility, which is advantageous for pharmaceutical applications. As with many compounds containing nitrogen heterocycles, it may exhibit various pharmacological properties, including analgesic or anti-inflammatory effects, although specific biological activities would require further investigation. Safety data and handling precautions should be adhered to, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₂H₂₁NO₂·ClH

InChI: InChI=1S/C12H21NO2.ClH/c14-12(11-2-1-3-11)15-9-6-10-4-7-13-8-5-10;/h10-11,13H,1-9H2;1H

InChI key: InChIKey=AOARLMXPKAVPRG-UHFFFAOYSA-N

SMILES: C(OCCC1CCNCC1)(=O)C2CCC2.Cl

Synonyms:

• Cyclobutanecarboxylic acid, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1)