CAS 1219960-71-0

3-[(3-Bromo[1,1′-biphenyl]-4-yl)oxy]azetidine

Description:

3-[(3-Bromo[1,1′-biphenyl]-4-yl)oxy]azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 3-bromo[1,1′-biphenyl]-4-yl group indicates that the compound has a bromine substituent on a biphenyl moiety, contributing to its potential reactivity and biological activity. This compound may exhibit interesting properties due to the combination of the azetidine ring and the aromatic biphenyl system, which can influence its solubility, stability, and interaction with biological targets. The bromine atom can also serve as a site for further chemical modifications or substitutions. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their structural diversity and ability to interact with various biological pathways. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or detailed literature references for precise values.

Formula: C₁₅H₁₄BrNO

InChI: InChI=1S/C15H14BrNO/c16-14-8-12(11-4-2-1-3-5-11)6-7-15(14)18-13-9-17-10-13/h1-8,13,17H,9-10H2

InChI key: InChIKey=PRPHGJIQEUMJEG-UHFFFAOYSA-N

SMILES: BrC=1C=C(C=CC1OC2CNC2)C3=CC=CC=C3

Synonyms:

• 3-[(3-Bromo[1,1′-biphenyl]-4-yl)oxy]azetidine
• Azetidine, 3-[(3-bromo[1,1′-biphenyl]-4-yl)oxy]-