
CAS 1219960-74-3
:Piperidine, 3-[(2-propylphenoxy)methyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[(2-propylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a propylphenoxy group attached to the third position of the piperidine ring, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and facilitates its use in various applications, including pharmaceuticals. The presence of the phenoxy group may influence the compound's interaction with biological targets, potentially affecting its pharmacological profile. Piperidine derivatives are often studied for their roles in medicinal chemistry, particularly in the development of analgesics, antidepressants, and other therapeutic agents. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound exemplifies the diverse chemistry of piperidine derivatives and their relevance in drug discovery and development.
Formula:C15H24ClNO
InChI:InChI=1S/C15H23NO.ClH/c1-2-6-14-8-3-4-9-15(14)17-12-13-7-5-10-16-11-13;/h3-4,8-9,13,16H,2,5-7,10-12H2,1H3;1H
InChI key:InChIKey=RDNULWFKGLFNKE-UHFFFAOYSA-N
SMILES:O(CC1CCCNC1)C2=C(CCC)C=CC=C2.Cl
Synonyms:- Piperidine, 3-[(2-propylphenoxy)methyl]-, hydrochloride (1:1)
- 3-[(2-Propylphenoxy)methyl]piperidinehydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.