CymitQuimica logo

CAS 1219960-77-6

:

3-(2-Chloro-4,6-dimethylphenoxy)azetidine

Description:
3-(2-Chloro-4,6-dimethylphenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a phenoxy group, specifically a 2-chloro-4,6-dimethylphenyl moiety, which contributes to its chemical properties and potential biological activity. The presence of chlorine and methyl groups on the aromatic ring can influence the compound's reactivity, solubility, and interaction with biological targets. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including agrochemicals or pharmaceuticals. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on environmental conditions such as pH, temperature, and the presence of solvents or other reagents. Safety and handling precautions should be observed due to the presence of chlorine, which can pose health risks.
Formula:C11H14ClNO
InChI:InChI=1S/C11H14ClNO/c1-7-3-8(2)11(10(12)4-7)14-9-5-13-6-9/h3-4,9,13H,5-6H2,1-2H3
InChI key:InChIKey=MKCPAKZFFOTCED-UHFFFAOYSA-N
SMILES:O(C1=C(C)C=C(C)C=C1Cl)C2CNC2
Synonyms:
  • 3-(2-Chloro-4,6-dimethylphenoxy)azetidine
  • Azetidine, 3-(2-chloro-4,6-dimethylphenoxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.