CAS 1219960-81-2

Morpholine, 4-[2-(3-piperidinyl)ethyl]-, hydrochloride (1:2)

Description:

Morpholine, 4-[2-(3-piperidinyl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its morpholine and piperidine moieties, which contribute to its unique properties. This substance typically appears as a white to off-white crystalline solid and is soluble in water, indicating its ionic nature due to the hydrochloride form. The presence of both morpholine and piperidine rings suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as these structures are often associated with biological activity. The compound's molecular structure allows for interactions with various biological targets, making it of interest in drug design. Additionally, the hydrochloride salt form enhances its stability and solubility, which are critical for formulation in pharmaceutical applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of structural features in determining biological activity.

Formula: C₁₁H₂₂N₂O·2ClH

InChI: InChI=1S/C11H22N2O.2ClH/c1-2-11(10-12-4-1)3-5-13-6-8-14-9-7-13;;/h11-12H,1-10H2;2*1H

InChI key: InChIKey=RBYQWJZYSROWCH-UHFFFAOYSA-N

SMILES: C(CN1CCOCC1)C2CCCNC2.Cl

Synonyms:

• Morpholine, 4-[2-(3-piperidinyl)ethyl]-, hydrochloride (1:2)