CAS 1219960-92-5
:2-[(5-Bromo-4-methyl-2-pyridinyl)ethylamino]ethanol
Description:
2-[(5-Bromo-4-methyl-2-pyridinyl)ethylamino]ethanol is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a methyl group. This compound features an ethanolamine moiety, indicating the presence of both an amine and an alcohol functional group. The bromine substitution on the pyridine ring can influence the compound's reactivity and biological activity, potentially enhancing its pharmacological properties. The presence of the ethylamino group suggests that it may interact with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's solubility and stability can be affected by the functional groups present, which may also play a role in its application in various chemical and pharmaceutical contexts. Overall, 2-[(5-Bromo-4-methyl-2-pyridinyl)ethylamino]ethanol is a compound that combines features of both aromatic and aliphatic chemistry, making it a subject of interest for further research and development.
Formula:C10H15BrN2O
InChI:InChI=1S/C10H15BrN2O/c1-3-13(4-5-14)10-6-8(2)9(11)7-12-10/h6-7,14H,3-5H2,1-2H3
InChI key:InChIKey=SQRXCMNPWNCNLC-UHFFFAOYSA-N
SMILES:N(CCO)(CC)C1=CC(C)=C(Br)C=N1
Synonyms:- 2-[(5-Bromo-4-methyl-2-pyridinyl)ethylamino]ethanol
- Ethanol, 2-[(5-bromo-4-methyl-2-pyridinyl)ethylamino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.