CymitQuimica logo

CAS 1219960-98-1

:

3-(2,4-Dibromophenoxy)azetidine

Description:
3-(2,4-Dibromophenoxy)azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 2,4-dibromophenoxy group indicates that the compound has two bromine substituents on the phenyl ring, which can significantly influence its chemical reactivity and physical properties. This compound may exhibit unique biological activities due to the presence of the dibromophenyl moiety, which can enhance lipophilicity and potentially affect its interaction with biological targets. The azetidine ring contributes to the compound's overall stability and may also play a role in its conformational flexibility. As with many halogenated compounds, 3-(2,4-Dibromophenoxy)azetidine may have implications for environmental persistence and toxicity, necessitating careful handling and assessment in both laboratory and industrial settings. Its specific applications and behavior in various chemical reactions would depend on the functional groups present and the overall molecular structure.
Formula:C9H9Br2NO
InChI:InChI=1S/C9H9Br2NO/c10-6-1-2-9(8(11)3-6)13-7-4-12-5-7/h1-3,7,12H,4-5H2
InChI key:InChIKey=QKVDOMWGHVFNMD-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=C(Br)C=C1)C2CNC2
Synonyms:
  • Azetidine, 3-(2,4-dibromophenoxy)-
  • 3-(2,4-Dibromophenoxy)azetidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.