CymitQuimica logo

CAS 1219961-02-0

:

2-Piperazinone, 4-(5-bromo-4-methyl-2-pyridinyl)-

Description:
2-Piperazinone, 4-(5-bromo-4-methyl-2-pyridinyl)- is a chemical compound characterized by its piperazinone core, which is a cyclic amide containing a piperazine ring. The presence of a 5-bromo-4-methyl-2-pyridinyl substituent indicates that the compound has a bromine atom and a methyl group attached to a pyridine ring, contributing to its unique properties. This structure suggests potential biological activity, as piperazine derivatives are often explored for their pharmacological effects. The compound may exhibit solubility in polar solvents due to the presence of the piperazinone moiety, while the bromine and methyl groups can influence its lipophilicity and reactivity. Additionally, the presence of halogens like bromine can enhance the compound's ability to participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. Overall, this compound's characteristics make it a subject of interest for further research in the fields of organic chemistry and pharmacology.
Formula:C10H12BrN3O
InChI:InChI=1S/C10H12BrN3O/c1-7-4-9(13-5-8(7)11)14-3-2-12-10(15)6-14/h4-5H,2-3,6H2,1H3,(H,12,15)
InChI key:InChIKey=LOZWPOBNWQUWSA-UHFFFAOYSA-N
SMILES:CC=1C=C(N=CC1Br)N2CC(=O)NCC2
Synonyms:
  • 2-Piperazinone, 4-(5-bromo-4-methyl-2-pyridinyl)-
  • 4-(5-Bromo-4-methylpyridin-2-yl)piperazin-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.