
CAS 1219961-05-3
:3-Pyrrolidinol, 1-[2-(4-piperidinyl)ethyl]-, hydrochloride (1:2)
Description:
3-Pyrrolidinol, 1-[2-(4-piperidinyl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its structural features, which include a pyrrolidine ring and a piperidine moiety. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous environments. It exhibits properties common to amines, such as basicity, and can participate in hydrogen bonding due to the presence of hydroxyl and amine functional groups. The presence of the piperidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various biological activities. The compound's molecular structure may influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. Additionally, the hydrochloride form can affect the stability and shelf-life of the substance. Safety and handling precautions are essential, as with many chemical substances, to mitigate any potential hazards associated with its use. Overall, this compound represents a class of organic molecules with significant relevance in chemical and pharmaceutical research.
Formula:C11H22N2O·2ClH
InChI:InChI=1S/C11H22N2O.2ClH/c14-11-4-8-13(9-11)7-3-10-1-5-12-6-2-10;;/h10-12,14H,1-9H2;2*1H
InChI key:InChIKey=NPVIMZAQFPDTLY-UHFFFAOYSA-N
SMILES:C(CC1CCNCC1)N2CCC(O)C2.Cl
Synonyms:- 3-Pyrrolidinol, 1-[2-(4-piperidinyl)ethyl]-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.