CAS 1219961-08-6

Pyrrolidine, 3-(4-chloro-3-methylphenoxy)-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-(4-chloro-3-methylphenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of a 4-chloro-3-methylphenoxy group indicates that the compound has a phenolic structure with a chlorine substituent and a methyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways. Its molecular structure suggests it could interact with various receptors or enzymes, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound's characteristics make it a subject of interest for further research in chemical and biological fields.

Formula: C₁₁H₁₄ClNO·ClH

InChI: InChI=1S/C11H14ClNO.ClH/c1-8-6-9(2-3-11(8)12)14-10-4-5-13-7-10;/h2-3,6,10,13H,4-5,7H2,1H3;1H

InChI key: InChIKey=POKXGVMCBOUGAO-UHFFFAOYSA-N

SMILES: O(C1=CC(C)=C(Cl)C=C1)C2CCNC2.Cl

Synonyms:

• Pyrrolidine, 3-(4-chloro-3-methylphenoxy)-, hydrochloride (1:1)