CymitQuimica logo

CAS 1219961-09-7

:

Piperidine, 2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-, hydrochloride (1:1)

Description:
Piperidine, 2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a 4-chloro-3,5-dimethylphenoxy group attached to a 2-ethyl chain, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various conditions. Its structure suggests potential interactions with biological systems, possibly influencing neurotransmitter pathways or other physiological processes. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound exemplifies the complexity of organic chemistry, where modifications to a basic structure can lead to significant changes in functionality and application.
Formula:C15H22ClNO·ClH
InChI:InChI=1S/C15H22ClNO.ClH/c1-11-9-14(10-12(2)15(11)16)18-8-6-13-5-3-4-7-17-13;/h9-10,13,17H,3-8H2,1-2H3;1H
InChI key:InChIKey=PWZAMSXLWVEFDT-UHFFFAOYSA-N
SMILES:O(CCC1CCCCN1)C2=CC(C)=C(Cl)C(C)=C2.Cl
Synonyms:
  • Piperidine, 2-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.