CAS 1219961-13-3

Piperidine, 2-[2-[(3-bromo[1,1′-biphenyl]-4-yl)oxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-[(3-bromo[1,1′-biphenyl]-4-yl)oxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a bromo-substituted biphenyl moiety indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates handling in laboratory settings. Its structure suggests that it may exhibit biological activity, possibly interacting with various biological targets due to the presence of the biphenyl and ether functionalities. The compound's molecular properties, such as its melting point, boiling point, and solubility, would be influenced by the functional groups present. Additionally, safety data sheets would provide information on its toxicity, handling precautions, and environmental impact, which are crucial for laboratory and industrial applications. Overall, this compound represents a class of organic molecules that may have significant implications in chemical research and drug development.

Formula: C₁₉H₂₂BrNO·ClH

InChI: InChI=1S/C19H22BrNO.ClH/c20-18-14-16(15-6-2-1-3-7-15)9-10-19(18)22-13-11-17-8-4-5-12-21-17;/h1-3,6-7,9-10,14,17,21H,4-5,8,11-13H2;1H

InChI key: InChIKey=PSKKZTRXUXLQGI-UHFFFAOYSA-N

SMILES: BrC=1C=C(C=CC1OCCC2CCCCN2)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 2-[2-[(3-bromo[1,1′-biphenyl]-4-yl)oxy]ethyl]-, hydrochloride (1:1)