CAS 1219961-14-4

3-[3-(1,1-Dimethylethyl)phenoxy]azetidine

Description:

3-[3-(1,1-Dimethylethyl)phenoxy]azetidine, identified by its CAS number 1219961-14-4, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. This compound features a phenoxy group, which is a phenyl ring bonded to an oxygen atom, and a tert-butyl group (1,1-dimethylethyl) that enhances its hydrophobic properties. The presence of these functional groups suggests that the compound may exhibit interesting biological activities, potentially serving as a ligand or a precursor in synthetic chemistry. Its molecular structure indicates that it may have applications in pharmaceuticals or agrochemicals, although specific biological activities or uses would require further investigation. The compound's stability, solubility, and reactivity would depend on the surrounding conditions, such as pH and temperature, as well as the presence of other reactive species. Overall, 3-[3-(1,1-Dimethylethyl)phenoxy]azetidine represents a unique structure that could be of interest in various fields of chemical research.

Formula: C₁₃H₁₉NO

InChI: InChI=1S/C13H19NO/c1-13(2,3)10-5-4-6-11(7-10)15-12-8-14-9-12/h4-7,12,14H,8-9H2,1-3H3

InChI key: InChIKey=KNUBXYPUEMLXNB-UHFFFAOYSA-N

SMILES: O(C1=CC(C(C)(C)C)=CC=C1)C2CNC2

Synonyms:

• Azetidine, 3-[3-(1,1-dimethylethyl)phenoxy]-
• 3-[3-(1,1-Dimethylethyl)phenoxy]azetidine