
CAS 1219961-21-3
:Piperidine, 3-[2-(2-bromo-4-ethylphenoxy)ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-(2-bromo-4-ethylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a substituent that includes a bromo-ethylphenoxy group, indicating the presence of a bromine atom and an ethylphenoxy moiety, which contributes to its overall hydrophobic character. The hydrochloride form suggests that the compound is a salt, enhancing its solubility in polar solvents, particularly water. This characteristic is significant for its potential applications in pharmaceuticals, as the hydrochloride form often improves the stability and bioavailability of the active compound. The presence of the bromine atom may also impart unique reactivity and biological activity, making it of interest in medicinal chemistry. Overall, this compound's structure suggests potential utility in various chemical and biological applications, although specific biological activities would require further investigation.
Formula:C15H22BrNO·ClH
InChI:InChI=1S/C15H22BrNO.ClH/c1-2-12-5-6-15(14(16)10-12)18-9-7-13-4-3-8-17-11-13;/h5-6,10,13,17H,2-4,7-9,11H2,1H3;1H
InChI key:InChIKey=NCNQHNUNAUIBCL-UHFFFAOYSA-N
SMILES:O(CCC1CCCNC1)C2=C(Br)C=C(CC)C=C2.Cl
Synonyms:- Piperidine, 3-[2-(2-bromo-4-ethylphenoxy)ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.