CAS 1219961-31-5

Piperidine, 2-[2-(2-bromo-4-ethylphenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-(2-bromo-4-ethylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a substituent that includes a bromo-ethylphenoxy group, indicating the presence of a bromine atom and an ethylphenoxy moiety, which contributes to its overall structure and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the bromine atom may impart specific reactivity or biological properties, making it of interest in medicinal chemistry. The compound's molecular interactions, stability, and reactivity can be influenced by the functional groups attached to the piperidine ring, which may affect its pharmacological profile. Overall, this compound is significant in research and development, particularly in the synthesis of novel therapeutic agents.

Formula: C₁₅H₂₂BrNO·ClH

InChI: InChI=1S/C15H22BrNO.ClH/c1-2-12-6-7-15(14(16)11-12)18-10-8-13-5-3-4-9-17-13;/h6-7,11,13,17H,2-5,8-10H2,1H3;1H

InChI key: InChIKey=MRYFZICDIDBYHM-UHFFFAOYSA-N

SMILES: O(CCC1CCCCN1)C2=C(Br)C=C(CC)C=C2.Cl

Synonyms:

• Piperidine, 2-[2-(2-bromo-4-ethylphenoxy)ethyl]-, hydrochloride (1:1)