CAS 1219961-34-8

3-[4-(1-Methyl-1-phenylethyl)phenoxy]azetidine

Description:

3-[4-(1-Methyl-1-phenylethyl)phenoxy]azetidine, identified by its CAS number 1219961-34-8, is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. This substance features a phenoxy group, indicating the presence of a phenyl ring bonded to an oxygen atom, which is further substituted with a 1-methyl-1-phenylethyl group. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. The compound's molecular structure may influence its solubility, stability, and reactivity, which are critical factors in its potential use. Additionally, the presence of the bulky 1-methyl-1-phenylethyl substituent may impart unique steric and electronic properties, affecting its biological activity and interaction with receptors or enzymes. Overall, this compound represents a class of organic molecules that could be of interest in various chemical and pharmaceutical research fields.

Formula: C₁₈H₂₁NO

InChI: InChI=1S/C18H21NO/c1-18(2,14-6-4-3-5-7-14)15-8-10-16(11-9-15)20-17-12-19-13-17/h3-11,17,19H,12-13H2,1-2H3

InChI key: InChIKey=YKGBYYUZXBPJMU-UHFFFAOYSA-N

SMILES: C(C)(C)(C1=CC=C(OC2CNC2)C=C1)C3=CC=CC=C3

Synonyms:

• Azetidine, 3-[4-(1-methyl-1-phenylethyl)phenoxy]-
• 3-[4-(1-Methyl-1-phenylethyl)phenoxy]azetidine