CAS 1219963-72-0

Piperidine, 2-[2-([1,1′-biphenyl]-4-yloxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 2-[2-([1,1′-biphenyl]-4-yloxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic amine. The structure features a biphenyl moiety substituted with a 4-ethoxy group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways. Its molecular interactions can be influenced by the presence of the biphenyl group, which may affect lipophilicity and receptor binding. Safety and handling precautions are essential, as with many amines and their salts, due to potential toxicity and reactivity. Overall, this compound's characteristics make it of interest in medicinal chemistry and related fields, where its specific interactions and effects can be further explored.

Formula: C₁₉H₂₃NO·ClH

InChI: InChI=1S/C19H23NO.ClH/c1-2-6-16(7-3-1)17-9-11-19(12-10-17)21-15-13-18-8-4-5-14-20-18;/h1-3,6-7,9-12,18,20H,4-5,8,13-15H2;1H

InChI key: InChIKey=LHWDKUBFRRCDGQ-UHFFFAOYSA-N

SMILES: O(CCC1CCCCN1)C2=CC=C(C=C2)C3=CC=CC=C3.Cl

Synonyms:

• 2-(2-([1,1′-Biphenyl]-4-yloxy)ethyl)piperidine hydrochloride
• Piperidine, 2-[2-([1,1′-biphenyl]-4-yloxy)ethyl]-, hydrochloride (1:1)