CAS 1219963-84-4

2-Piperazinone, 4-(2-piperidinylmethyl)-, hydrochloride (1:2)

Description:

2-Piperazinone, 4-(2-piperidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperazine and piperidine moieties, which contribute to its potential biological activity. This substance typically appears as a white to off-white crystalline powder and is soluble in water and various organic solvents, reflecting its polar nature due to the presence of the hydrochloride salt. The compound's structure suggests it may exhibit properties relevant to pharmacology, particularly in the development of therapeutic agents targeting central nervous system disorders. Its molecular framework allows for interactions with neurotransmitter systems, which may be of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical, due to potential toxicity or reactivity. As with many compounds in this class, further research is necessary to fully elucidate its pharmacokinetics, mechanisms of action, and potential applications in drug development.

Formula: C₁₀H₁₉N₃O·2ClH

InChI: InChI=1S/C10H19N3O.2ClH/c14-10-8-13(6-5-12-10)7-9-3-1-2-4-11-9;;/h9,11H,1-8H2,(H,12,14);2*1H

InChI key: InChIKey=NPECEHHGSKLLDJ-UHFFFAOYSA-N

SMILES: C(N1CC(=O)NCC1)C2CCCCN2.Cl

Synonyms:

• 2-Piperazinone, 4-(2-piperidinylmethyl)-, hydrochloride (1:2)