CymitQuimica logo

CAS 1219963-85-5

:

3-(3-Ethoxyphenoxy)azetidine

Description:
3-(3-Ethoxyphenoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocycle containing one nitrogen atom. The structure features a phenoxy group, specifically a 3-ethoxy-substituted phenyl moiety, which contributes to its unique properties. This compound may exhibit moderate polarity due to the presence of the ethoxy group, influencing its solubility in various solvents. The azetidine ring can impart certain reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of the phenoxy group may enhance its biological activity, making it of interest in medicinal chemistry. The compound's molecular interactions, stability, and reactivity can be influenced by factors such as temperature and pH. Overall, 3-(3-Ethoxyphenoxy)azetidine represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, although specific biological or industrial applications would require further investigation.
Formula:C11H15NO2
InChI:InChI=1S/C11H15NO2/c1-2-13-9-4-3-5-10(6-9)14-11-7-12-8-11/h3-6,11-12H,2,7-8H2,1H3
InChI key:InChIKey=UMZSJTVTLZVCCJ-UHFFFAOYSA-N
SMILES:O(C1=CC(OCC)=CC=C1)C2CNC2
Synonyms:
  • Azetidine, 3-(3-ethoxyphenoxy)-
  • 3-(3-Ethoxyphenoxy)azetidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.