CAS 1219964-09-6

Propanamide, 2-amino-2-methyl-N-phenyl-, hydrochloride (1:1)

Description:

Propanamide, 2-amino-2-methyl-N-phenyl-, hydrochloride (1:1), also known as a specific amide derivative, exhibits several notable characteristics. This compound features a propanamide backbone with an amino group and a phenyl substituent, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its interaction with biological targets. The compound's structure indicates potential for use in medicinal chemistry, possibly as an intermediate in the synthesis of more complex molecules or as a pharmacologically active agent. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. As with many amides, it may exhibit moderate to low toxicity, necessitating careful handling and assessment in laboratory settings. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₀H₁₄N₂O·ClH

InChI: InChI=1S/C10H14N2O.ClH/c1-10(2,11)9(13)12-8-6-4-3-5-7-8;/h3-7H,11H2,1-2H3,(H,12,13);1H

InChI key: InChIKey=PHBWTIXAZQCHMQ-UHFFFAOYSA-N

SMILES: N(C(C(C)(C)N)=O)C1=CC=CC=C1.Cl

Synonyms:

• Propanamide, 2-amino-2-methyl-N-phenyl-, hydrochloride (1:1)