CAS 1219964-28-9

2-Piperidinemethanamine, N,N-di-2-propen-1-yl-, hydrochloride (1:2)

Description:

2-Piperidinemethanamine, N,N-di-2-propen-1-yl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This substance features a methanamine group and two propenyl substituents, contributing to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, including pharmaceuticals and research. The presence of the piperidine moiety suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Its molecular structure allows for various functional group modifications, which can influence its pharmacological properties. Safety data and handling precautions should be observed, as with any chemical compound, particularly those with biological activity. Overall, this compound's unique structure and properties make it a subject of interest in synthetic organic chemistry and drug development.

Formula: C₁₂H₂₂N₂·2ClH

InChI: InChI=1S/C12H22N2.2ClH/c1-3-9-14(10-4-2)11-12-7-5-6-8-13-12;;/h3-4,12-13H,1-2,5-11H2;2*1H

InChI key: InChIKey=YABRNPHQSUWTOB-UHFFFAOYSA-N

SMILES: N(CC1CCCCN1)(CC=C)CC=C.Cl

Synonyms:

• 2-Piperidinemethanamine, N,N-di-2-propen-1-yl-, hydrochloride (1:2)