
CAS 1219964-32-5
:Propanamide, 2-amino-N-(3-ethoxypropyl)-2-methyl-, hydrochloride (1:1)
Description:
Propanamide, 2-amino-N-(3-ethoxypropyl)-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule with hydrogen bonding capabilities. The presence of the ethoxypropyl group suggests that it has moderate hydrophobic characteristics, while the amino group contributes to its basicity and potential for forming salts, as evidenced by its hydrochloride form. This compound is likely to exhibit solubility in polar solvents due to its ionic nature when in hydrochloride form. Its structure implies that it may participate in various chemical reactions typical of amides and amines, such as nucleophilic substitutions or acylation reactions. Additionally, the presence of both ethyl and propyl groups may influence its lipophilicity and biological activity, making it of interest in medicinal chemistry. Overall, this compound's unique combination of functional groups positions it as a versatile molecule for further research and potential applications in pharmaceuticals or agrochemicals.
Formula:C9H20N2O2·ClH
InChI:InChI=1S/C9H20N2O2.ClH/c1-4-13-7-5-6-11-8(12)9(2,3)10;/h4-7,10H2,1-3H3,(H,11,12);1H
InChI key:InChIKey=LCDJOQLVIRJKGY-UHFFFAOYSA-N
SMILES:C(NCCCOCC)(C(C)(C)N)=O.Cl
Synonyms:- Propanamide, 2-amino-N-(3-ethoxypropyl)-2-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.