CymitQuimica logo

CAS 1219964-39-2

:

5-Bromo-N-(3-methylphenyl)-2-pyridinamine

Description:
5-Bromo-N-(3-methylphenyl)-2-pyridinamine is an organic compound characterized by its bromine substitution and the presence of a pyridine ring. It features a bromine atom attached to the fifth position of the pyridine ring, while the nitrogen atom in the amine group is substituted with a 3-methylphenyl group. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the bromine atom and the amine functional group, which can influence biological activity. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C12H11BrN2
InChI:InChI=1S/C12H11BrN2/c1-9-3-2-4-11(7-9)15-12-6-5-10(13)8-14-12/h2-8H,1H3,(H,14,15)
InChI key:InChIKey=ZCJOIAUDKSMFLP-UHFFFAOYSA-N
SMILES:N(C1=CC(C)=CC=C1)C2=CC=C(Br)C=N2
Synonyms:
  • 5-Bromo-N-(3-methylphenyl)-2-pyridinamine
  • 2-Pyridinamine, 5-bromo-N-(3-methylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.