CAS 1219964-56-3

2-Piperidinemethanamine, N,N-diethyl-, hydrochloride (1:2)

Description:

2-Piperidinemethanamine, N,N-diethyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a diethylamino group attached to the piperidine, contributing to its basicity and potential for forming salts, such as the hydrochloride form. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The presence of the amine functional group suggests that it may participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. Additionally, the compound may exhibit properties typical of amines, such as being a nucleophile and potentially acting as a ligand in coordination chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₀H₂₂N₂·2ClH

InChI: InChI=1S/C10H22N2.2ClH/c1-3-12(4-2)9-10-7-5-6-8-11-10;;/h10-11H,3-9H2,1-2H3;2*1H

InChI key: InChIKey=RFCSDISMBSJWSY-UHFFFAOYSA-N

SMILES: C(N(CC)CC)C1CCCCN1.Cl

Synonyms:

• 2-Piperidinemethanamine, N,N-diethyl-, hydrochloride (1:2)

N-Ethyl-N-(2-piperidinylmethyl)-1-ethanamine dihydrochloride

CAS: 1219964-56-3

Versatile small molecule scaffold

Formula: C₁₀H₂₄Cl₂N₂

Purity: Min. 95%

Molecular weight: 243.22 g/mol

Ref: 3D-UYB96456