CAS 1219964-57-4

Isoquinoline, 1,2,3,4-tetrahydro-2-(2-piperidinylmethyl)-, hydrochloride (1:2)

Description:

Isoquinoline, 1,2,3,4-tetrahydro-2-(2-piperidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline core and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its hydrochloride salt form. The presence of the piperidinylmethyl group suggests potential biological activity, making it of interest in medicinal chemistry and pharmacology. Isoquinoline derivatives are known for their diverse pharmacological properties, including antitumor, analgesic, and antimicrobial activities. The hydrochloride salt form enhances the compound's stability and solubility, facilitating its use in various applications. As with many isoquinoline derivatives, the compound may exhibit interactions with neurotransmitter systems, which could be relevant for therapeutic development. However, specific biological activities and safety profiles would require further investigation through experimental studies.

Formula: C₁₅H₂₂N₂·2ClH

InChI: InChI=1S/C15H22N2.2ClH/c1-2-6-14-11-17(10-8-13(14)5-1)12-15-7-3-4-9-16-15;;/h1-2,5-6,15-16H,3-4,7-12H2;2*1H

InChI key: InChIKey=OBUBMLZTGHDWAA-UHFFFAOYSA-N

SMILES: C(N1CC=2C(CC1)=CC=CC2)C3CCCCN3.Cl

Synonyms:

• Isoquinoline, 1,2,3,4-tetrahydro-2-(2-piperidinylmethyl)-, hydrochloride (1:2)