CymitQuimica logo

CAS 1219964-58-5

:

Piperidine, 4-[2-(2-bromo-4-ethylphenoxy)ethyl]-, hydrochloride (1:1)

Description:
Piperidine, 4-[2-(2-bromo-4-ethylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a substituent that includes a bromo-ethylphenoxy group, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the bromine atom may impart specific reactivity and influence the compound's interaction with biological targets. The compound's structure suggests potential use in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of more complex molecules. Safety and handling precautions are essential due to the presence of bromine, which can be hazardous. Overall, this compound exemplifies the diverse functionalities that can be achieved through the modification of piperidine derivatives.
Formula:C15H22BrNO·ClH
InChI:InChI=1S/C15H22BrNO.ClH/c1-2-12-3-4-15(14(16)11-12)18-10-7-13-5-8-17-9-6-13;/h3-4,11,13,17H,2,5-10H2,1H3;1H
InChI key:InChIKey=IJRNMMQLVQKVFV-UHFFFAOYSA-N
SMILES:O(CCC1CCNCC1)C2=C(Br)C=C(CC)C=C2.Cl
Synonyms:
  • Piperidine, 4-[2-(2-bromo-4-ethylphenoxy)ethyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.