CAS 1219964-59-6

Piperidine, 3-[2-(4-bromo-3-methylphenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-(4-bromo-3-methylphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a side chain that includes a 4-bromo-3-methylphenoxy group, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the bromine atom and the methyl group on the aromatic ring may influence its reactivity and interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, including potential use in drug development or as a research chemical. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.

Formula: C₁₄H₂₀BrNO·ClH

InChI: InChI=1S/C14H20BrNO.ClH/c1-11-9-13(4-5-14(11)15)17-8-6-12-3-2-7-16-10-12;/h4-5,9,12,16H,2-3,6-8,10H2,1H3;1H

InChI key: InChIKey=KQESFUYKCGPOBN-UHFFFAOYSA-N

SMILES: O(CCC1CCCNC1)C2=CC(C)=C(Br)C=C2.Cl

Synonyms:

• Piperidine, 3-[2-(4-bromo-3-methylphenoxy)ethyl]-, hydrochloride (1:1)