CAS 1219964-62-1
:5-Bromo-4-methyl-N-(phenylmethyl)-2-pyridinamine
Description:
5-Bromo-4-methyl-N-(phenylmethyl)-2-pyridinamine is an organic compound characterized by its complex structure, which includes a pyridine ring substituted with a bromine atom and a methyl group, as well as an amine functional group linked to a phenylmethyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the bromine atom may impart unique reactivity, making it a candidate for various chemical transformations, such as nucleophilic substitutions or coupling reactions. The amine group can participate in hydrogen bonding, influencing its interactions in biological systems or with other chemical entities. Due to its structural features, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C13H13BrN2
InChI:InChI=1S/C13H13BrN2/c1-10-7-13(16-9-12(10)14)15-8-11-5-3-2-4-6-11/h2-7,9H,8H2,1H3,(H,15,16)
InChI key:InChIKey=ZENHOQKEQUCHHL-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)C2=CC(C)=C(Br)C=N2
Synonyms:- 2-Pyridinamine, 5-bromo-4-methyl-N-(phenylmethyl)-
- 5-Bromo-4-methyl-N-(phenylmethyl)-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.