CAS 1219967-17-5

Piperidine, 4-[2-(cyclopropylmethoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-(cyclopropylmethoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a cyclopropylmethoxy group attached to the 4-position of the piperidine ring, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it suitable for various applications in pharmaceutical and chemical research. The presence of the cyclopropyl group may influence its biological activity and pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential use in drug development, as piperidine derivatives are often associated with various therapeutic effects. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity. Further studies would be necessary to fully elucidate its biological activity and potential applications.

Formula: C₁₁H₂₁NO·ClH

InChI: InChI=1S/C11H21NO.ClH/c1-2-11(1)9-13-8-5-10-3-6-12-7-4-10;/h10-12H,1-9H2;1H

InChI key: InChIKey=FSSVWOMRVKOWSE-UHFFFAOYSA-N

SMILES: C(OCCC1CCNCC1)C2CC2.Cl

Synonyms:

• Piperidine, 4-[2-(cyclopropylmethoxy)ethyl]-, hydrochloride (1:1)