CAS 1219967-24-4

Piperidine, 3-[2-[(5-bromo[1,1′-biphenyl]-2-yl)oxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-[(5-bromo[1,1′-biphenyl]-2-yl)oxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a bromo-substituted biphenyl moiety indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its handling in laboratory settings. Its structure suggests that it may exhibit biological activity, possibly acting as a ligand or inhibitor in various biochemical pathways. The bromine substituent can influence the compound's electronic properties and reactivity, making it a candidate for further study in organic synthesis or drug design. As with many piperidine derivatives, it may possess psychoactive properties, although specific pharmacological effects would require empirical investigation. Safety data and handling precautions should be observed due to the presence of halogenated compounds, which can pose environmental and health risks.

Formula: C₁₉H₂₂BrNO·ClH

InChI: InChI=1S/C19H22BrNO.ClH/c20-17-8-9-19(18(13-17)16-6-2-1-3-7-16)22-12-10-15-5-4-11-21-14-15;/h1-3,6-9,13,15,21H,4-5,10-12,14H2;1H

InChI key: InChIKey=RELWEKCLZJKGLQ-UHFFFAOYSA-N

SMILES: O(CCC1CCCNC1)C2=C(C=C(Br)C=C2)C3=CC=CC=C3.Cl

Synonyms:

• Piperidine, 3-[2-[(5-bromo[1,1′-biphenyl]-2-yl)oxy]ethyl]-, hydrochloride (1:1)