CymitQuimica logo

CAS 1219967-26-6

:

Piperidine, 4-[2-(2-fluoroethoxy)ethyl]-, hydrochloride (1:1)

Description:
Piperidine, 4-[2-(2-fluoroethoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of the 2-fluoroethoxy group indicates that the compound has a fluorinated ethyl ether substituent, which can influence its reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit properties such as basicity due to the nitrogen atom in the piperidine ring, and its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the fluorine atom can impart unique electronic properties, potentially affecting the compound's pharmacokinetics and pharmacodynamics. Overall, this compound's characteristics make it a subject of interest for further research in drug development and related fields.
Formula:C9H18FNO·ClH
InChI:InChI=1S/C9H18FNO.ClH/c10-4-8-12-7-3-9-1-5-11-6-2-9;/h9,11H,1-8H2;1H
InChI key:InChIKey=ZJKZGMMIRBJREL-UHFFFAOYSA-N
SMILES:C(COCCF)C1CCNCC1.Cl
Synonyms:
  • Piperidine, 4-[2-(2-fluoroethoxy)ethyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.