CAS 1219967-32-4
:1-(5-Bromo-4-methyl-2-pyridinyl)-4-methylpiperazine
Description:
1-(5-Bromo-4-methyl-2-pyridinyl)-4-methylpiperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring substituted with a pyridine moiety. The presence of a bromine atom and a methyl group on the pyridine ring contributes to its chemical reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the inclusion of nitrogen atoms in both the piperazine and pyridine rings. It may exhibit properties such as solubility in polar solvents, and its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's specific characteristics, including melting point, boiling point, and spectral data, would depend on its purity and the conditions under which it is studied. Additionally, its safety profile and handling precautions would be essential for laboratory work, as with many brominated compounds, which can pose environmental and health risks.
Formula:C11H16BrN3
InChI:InChI=1S/C11H16BrN3/c1-9-7-11(13-8-10(9)12)15-5-3-14(2)4-6-15/h7-8H,3-6H2,1-2H3
InChI key:InChIKey=WCOZEBJJPANQBY-UHFFFAOYSA-N
SMILES:CC=1C=C(N=CC1Br)N2CCN(C)CC2
Synonyms:- Piperazine, 1-(5-bromo-4-methyl-2-pyridinyl)-4-methyl-
- 1-(5-Bromo-4-methyl-2-pyridinyl)-4-methylpiperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
