
CAS 1219967-40-4
:Piperidine, 3-[2-[2-nitro-4-(trifluoromethyl)phenoxy]ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 3-[2-[2-nitro-4-(trifluoromethyl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. This compound features a nitro group and a trifluoromethyl group attached to a phenoxyethyl side chain, contributing to its unique chemical properties. The presence of the hydrochloride indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The trifluoromethyl group often imparts significant lipophilicity, which can influence the compound's biological activity and pharmacokinetics. Additionally, the nitro group can participate in various chemical reactions, potentially affecting the compound's reactivity and stability. Overall, this compound's structure suggests potential utility in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific safety and handling guidelines should be followed due to the presence of the nitro group, which can pose health risks.
Formula:C14H17F3N2O3·ClH
InChI:InChI=1S/C14H17F3N2O3.ClH/c15-14(16,17)11-3-4-13(12(8-11)19(20)21)22-7-5-10-2-1-6-18-9-10;/h3-4,8,10,18H,1-2,5-7,9H2;1H
InChI key:InChIKey=OCWCFVXJILKZTJ-UHFFFAOYSA-N
SMILES:O(CCC1CCCNC1)C2=C(N(=O)=O)C=C(C(F)(F)F)C=C2.Cl
Synonyms:- Piperidine, 3-[2-[2-nitro-4-(trifluoromethyl)phenoxy]ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.