
CAS 1219967-42-6
:2-Chloro-6-(3-methyl-1-piperidinyl)pyrazine
Description:
2-Chloro-6-(3-methyl-1-piperidinyl)pyrazine is a chemical compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 2-position and a 3-methyl-1-piperidinyl group at the 6-position contributes to its unique properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its moderate polarity. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The piperidinyl group can enhance the compound's interaction with biological targets, potentially influencing its pharmacokinetics and pharmacodynamics. Additionally, the chlorine substituent can affect the compound's reactivity and stability. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H14ClN3
InChI:InChI=1S/C10H14ClN3/c1-8-3-2-4-14(7-8)10-6-12-5-9(11)13-10/h5-6,8H,2-4,7H2,1H3
InChI key:InChIKey=HUHYVRHJMZWXIQ-UHFFFAOYSA-N
SMILES:ClC=1N=C(C=NC1)N2CC(C)CCC2
Synonyms:- 2-Chloro-6-(3-methyl-1-piperidinyl)pyrazine
- Pyrazine, 2-chloro-6-(3-methyl-1-piperidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.