CAS 1219967-45-9

Ethyl 3-amino-4-(2,3-dihydro-1H-indol-1-yl)benzoate

Description:

Ethyl 3-amino-4-(2,3-dihydro-1H-indol-1-yl)benzoate, identified by its CAS number 1219967-45-9, is a chemical compound that features a complex structure combining an ethyl ester with an amino group and an indole moiety. This compound typically exhibits characteristics common to aromatic amines and esters, including moderate solubility in organic solvents and potential reactivity due to the presence of both the amino and ester functional groups. The indole structure contributes to its potential biological activity, as indole derivatives are often associated with various pharmacological properties. The compound may participate in hydrogen bonding due to the amino group, influencing its interactions in biological systems. Additionally, its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be evaluated in detail.

Formula: C₁₇H₁₈N₂O₂

InChI: InChI=1S/C17H18N2O2/c1-2-21-17(20)13-7-8-16(14(18)11-13)19-10-9-12-5-3-4-6-15(12)19/h3-8,11H,2,9-10,18H2,1H3

InChI key: InChIKey=QMJMYYNGBFGUNC-UHFFFAOYSA-N

SMILES: NC1=C(N2C=3C(CC2)=CC=CC3)C=CC(C(OCC)=O)=C1

Synonyms:

• Ethyl 3-amino-4-(2,3-dihydro-1H-indol-1-yl)benzoate
• Benzoic acid, 3-amino-4-(2,3-dihydro-1H-indol-1-yl)-, ethyl ester