CymitQuimica logo

CAS 1219967-57-3

:

Pyrimidine, 4-chloro-6-(2-ethyl-1-piperidinyl)-

Description:
Pyrimidine, 4-chloro-6-(2-ethyl-1-piperidinyl)- is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 4-position and a 2-ethyl-1-piperidinyl group at the 6-position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine atom and the piperidinyl group, which can influence its solubility in various solvents. Pyrimidines are known for their biological significance, often serving as building blocks in nucleic acids and as intermediates in the synthesis of pharmaceuticals. The specific substitution pattern in this compound may impart distinct pharmacological activities, making it of interest in medicinal chemistry. Additionally, the presence of the piperidinyl moiety may enhance its interaction with biological targets, potentially influencing its efficacy and safety profile in therapeutic applications.
Formula:C11H16ClN3
InChI:InChI=1S/C11H16ClN3/c1-2-9-5-3-4-6-15(9)11-7-10(12)13-8-14-11/h7-9H,2-6H2,1H3
InChI key:InChIKey=ZCNVCNQVGGQFDZ-UHFFFAOYSA-N
SMILES:C(C)C1N(CCCC1)C=2C=C(Cl)N=CN2
Synonyms:
  • Pyrimidine, 4-chloro-6-(2-ethyl-1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.