CymitQuimica logo

CAS 1219967-64-2

:

Piperidine, 4-(2-butoxyethyl)-, hydrochloride (1:1)

Description:
Piperidine, 4-(2-butoxyethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a butoxyethyl side chain at the 4-position of the piperidine ring, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and chemical synthesis. The presence of the butoxyethyl group may influence its lipophilicity and biological activity, potentially affecting its interaction with biological systems. This compound is likely to exhibit basic properties due to the nitrogen atom in the piperidine ring, allowing it to form salts with acids. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C11H23NO·ClH
InChI:InChI=1S/C11H23NO.ClH/c1-2-3-9-13-10-6-11-4-7-12-8-5-11;/h11-12H,2-10H2,1H3;1H
InChI key:InChIKey=ZVBGSHNEBGGTBP-UHFFFAOYSA-N
SMILES:C(COCCCC)C1CCNCC1.Cl
Synonyms:
  • Piperidine, 4-(2-butoxyethyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.