CAS 1219967-79-9
:N-Butyl-6-chloro-N-methyl-4-pyrimidinamine
Description:
N-Butyl-6-chloro-N-methyl-4-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a butyl group and a methyl group attached to the nitrogen atoms contributes to its unique properties. The chlorine substituent at the 6-position of the pyrimidine ring enhances its reactivity and may influence its biological activity. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of potential therapeutic agents. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many nitrogen-containing heterocycles, it may exhibit interesting interactions with biological targets, making it a subject of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H14ClN3
InChI:InChI=1S/C9H14ClN3/c1-3-4-5-13(2)9-6-8(10)11-7-12-9/h6-7H,3-5H2,1-2H3
InChI key:InChIKey=NXDRFPYPPUYHEG-UHFFFAOYSA-N
SMILES:N(CCCC)(C)C=1C=C(Cl)N=CN1
Synonyms:- 4-Pyrimidinamine, N-butyl-6-chloro-N-methyl-
- N-Butyl-6-chloro-N-methyl-4-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.