CAS 1219967-80-2

Pyrrolidine, 3-[[4-(2-methoxyethyl)phenoxy]methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[[4-(2-methoxyethyl)phenoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a phenoxy group substituted with a 2-methoxyethyl moiety contributes to its unique properties, potentially influencing its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its molecular structure suggests potential interactions with biological targets, which could be explored in medicinal chemistry. The hydrochloride form often enhances the compound's pharmacokinetic properties, such as absorption and distribution. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties, mechanisms of action, and potential applications in various fields.

Formula: C₁₄H₂₁NO₂·ClH

InChI: InChI=1S/C14H21NO2.ClH/c1-16-9-7-12-2-4-14(5-3-12)17-11-13-6-8-15-10-13;/h2-5,13,15H,6-11H2,1H3;1H

InChI key: InChIKey=RQSCPXRBPUBBOF-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=CC=C(CCOC)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[[4-(2-methoxyethyl)phenoxy]methyl]-, hydrochloride (1:1)