CAS 1219967-96-0

Piperidine, 4-[2-(4-bromo-2-nitrophenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-(4-bromo-2-nitrophenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic amine. The presence of a 4-bromo-2-nitrophenoxyethyl substituent indicates that it has both bromine and nitro functional groups, contributing to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and chemical research. The compound may exhibit properties such as being a potential ligand or intermediate in organic synthesis. Its molecular structure suggests it could interact with biological systems, making it of interest in medicinal chemistry. Safety and handling precautions should be observed due to the presence of bromine and nitro groups, which can impart toxicity and environmental concerns. Overall, this compound represents a specific class of piperidine derivatives with potential applications in drug development and chemical synthesis.

Formula: C₁₃H₁₇BrN₂O₃·ClH

InChI: InChI=1S/C13H17BrN2O3.ClH/c14-11-1-2-13(12(9-11)16(17)18)19-8-5-10-3-6-15-7-4-10;/h1-2,9-10,15H,3-8H2;1H

InChI key: InChIKey=YMJQEOGWVCTJAI-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(OCCC2CCNCC2)C=CC(Br)=C1.Cl

Synonyms:

• Piperidine, 4-[2-(4-bromo-2-nitrophenoxy)ethyl]-, hydrochloride (1:1)