
CAS 1219968-00-9
:Piperidine, 4-[2-[3-(trifluoromethyl)phenoxy]ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[2-[3-(trifluoromethyl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a trifluoromethyl group attached to a phenoxyethyl side chain, enhancing its lipophilicity and potentially influencing its biological activity. The hydrochloride form indicates that the compound is a salt, which typically improves its solubility in water and stability. The presence of the trifluoromethyl group often imparts unique electronic properties, making it of interest in medicinal chemistry and drug design. Piperidine derivatives are known for their diverse pharmacological activities, including analgesic, anti-inflammatory, and central nervous system effects. The specific interactions and efficacy of this compound would depend on its molecular structure and the presence of functional groups, which can affect its binding affinity to biological targets. As with any chemical substance, safety data and handling precautions should be consulted, particularly due to the potential toxicity associated with fluorinated compounds.
Formula:C14H18F3NO·ClH
InChI:InChI=1S/C14H18F3NO.ClH/c15-14(16,17)12-2-1-3-13(10-12)19-9-6-11-4-7-18-8-5-11;/h1-3,10-11,18H,4-9H2;1H
InChI key:InChIKey=XXNWHIRBVFEELZ-UHFFFAOYSA-N
SMILES:O(CCC1CCNCC1)C2=CC(C(F)(F)F)=CC=C2.Cl
Synonyms:- Piperidine, 4-[2-[3-(trifluoromethyl)phenoxy]ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.