CAS 1219968-05-4
:4-(5-Bromo-3-methyl-2-pyridinyl)-2-piperazinone
Description:
4-(5-Bromo-3-methyl-2-pyridinyl)-2-piperazinone is a chemical compound characterized by its unique structure, which includes a piperazinone moiety and a brominated pyridine ring. This compound features a piperazine ring, a six-membered heterocyclic structure containing two nitrogen atoms, which contributes to its potential biological activity. The presence of the bromine atom and the methyl group on the pyridine ring can influence the compound's reactivity and solubility, as well as its interaction with biological targets. The compound is likely to exhibit properties typical of piperazine derivatives, such as potential pharmacological effects, making it of interest in medicinal chemistry. Its specific applications may vary, but it could be explored for use in drug development or as a research tool in studying various biological processes. As with many synthetic compounds, safety and handling precautions should be observed, given the potential hazards associated with brominated compounds and nitrogen-containing heterocycles.
Formula:C10H12BrN3O
InChI:InChI=1S/C10H12BrN3O/c1-7-4-8(11)5-13-10(7)14-3-2-12-9(15)6-14/h4-5H,2-3,6H2,1H3,(H,12,15)
InChI key:InChIKey=FPJZKEIFKAEAQN-UHFFFAOYSA-N
SMILES:CC1=C(N2CC(=O)NCC2)N=CC(Br)=C1
Synonyms:- 4-(5-Bromo-3-methyl-2-pyridinyl)-2-piperazinone
- 2-Piperazinone, 4-(5-bromo-3-methyl-2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.