CAS 1219968-10-1

Cyclopropanecarboxylic acid, 4-piperidinylmethyl ester, hydrochloride (1:1)

Description:

Cyclopropanecarboxylic acid, 4-piperidinylmethyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its polar nature due to the presence of the hydrochloride salt. The piperidine ring contributes to its basicity, while the cyclopropanecarboxylic acid component may impart specific reactivity, particularly in organic synthesis. This compound is of interest in medicinal chemistry, potentially serving as a precursor or intermediate in the development of pharmaceuticals. Its hydrochloride form enhances stability and solubility, making it suitable for various applications, including biological assays. As with many chemical substances, handling should be conducted with care, adhering to safety protocols to mitigate any potential hazards associated with its use.

Formula: C₁₀H₁₇NO₂·ClH

InChI: InChI=1S/C10H17NO2.ClH/c12-10(9-1-2-9)13-7-8-3-5-11-6-4-8;/h8-9,11H,1-7H2;1H

InChI key: InChIKey=JFLUBISFQGIEQW-UHFFFAOYSA-N

SMILES: C(OCC1CCNCC1)(=O)C2CC2.Cl

Synonyms:

• Cyclopropanecarboxylic acid, 4-piperidinylmethyl ester, hydrochloride (1:1)