CAS 1219971-86-4

Pyrrolidine, 3-[(4-chloro-3,5-dimethylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(4-chloro-3,5-dimethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a phenoxy group substituted with a chloro and two methyl groups, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the chloro and methyl substituents can influence the compound's biological activity, potentially affecting its interaction with biological targets. This compound may exhibit specific pharmacological effects, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Its precise applications and effects would depend on further research and characterization, including studies on its pharmacodynamics and pharmacokinetics.

Formula: C₁₃H₁₈ClNO.ClH

InChI: InChI=1S/C13H18ClNO.ClH/c1-9-5-12(6-10(2)13(9)14)16-8-11-3-4-15-7-11;/h5-6,11,15H,3-4,7-8H2,1-2H3;1H

InChI key: InChIKey=XNSWCSKIJJESTC-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=CC(C)=C(Cl)C(C)=C2.Cl