CAS 1219971-88-6

Piperidine, 4-[4-(1,1-dimethylethyl)-2-methylphenoxy]-, hydrochloride (1:1)

Description:

Piperidine, 4-[4-(1,1-dimethylethyl)-2-methylphenoxy]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a phenoxy group substituted with a tert-butyl and a methyl group, contributing to its unique structural and chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the piperidine moiety often imparts basicity, allowing it to interact with various biological targets. Its specific characteristics, such as melting point, solubility, and reactivity, can vary based on the conditions and the presence of other substances. Safety data should be consulted for handling and storage, as with any chemical compound, to ensure proper precautions are taken. Overall, this compound's structure suggests potential applications in medicinal chemistry and related fields.

Formula: C₁₆H₂₅NO·ClH

InChI: InChI=1S/C16H25NO.ClH/c1-12-11-13(16(2,3)4)5-6-15(12)18-14-7-9-17-10-8-14;/h5-6,11,14,17H,7-10H2,1-4H3;1H

InChI key: InChIKey=KORSMSMTHDWXNG-UHFFFAOYSA-N

SMILES: O(C1=C(C)C=C(C(C)(C)C)C=C1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-[4-(1,1-dimethylethyl)-2-methylphenoxy]-, hydrochloride (1:1)