
CAS 1219971-94-4
:Piperidine, 4-[(2-chloro-4,6-dimethylphenoxy)methyl]-, hydrochloride (1:1)
Description:
Piperidine, 4-[(2-chloro-4,6-dimethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a chloro-substituted phenoxy group, which contributes to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the chloro and dimethyl groups on the phenoxy moiety may influence the compound's lipophilicity and reactivity, making it of interest in medicinal chemistry. This compound may exhibit properties such as analgesic, anti-inflammatory, or other pharmacological activities, although specific biological effects would depend on further empirical studies. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C14H20ClNO·ClH
InChI:InChI=1S/C14H20ClNO.ClH/c1-10-7-11(2)14(13(15)8-10)17-9-12-3-5-16-6-4-12;/h7-8,12,16H,3-6,9H2,1-2H3;1H
InChI key:InChIKey=FGGDSMBMVRSHPE-UHFFFAOYSA-N
SMILES:O(CC1CCNCC1)C2=C(C)C=C(C)C=C2Cl.Cl
Synonyms:- Piperidine, 4-[(2-chloro-4,6-dimethylphenoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.